C9H15NO6 — CID 134895585
(3aR,4S,7S,7aS)-2,2,4-trimethyl-6-nitro-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-ol (PubChem CID 134895585) has the molecular formula C9H15NO6 and a molecular weight of 233.22 g/mol. Its IUPAC name is (3aR,4S,7S,7aS)-2,2,4-trimethyl-6-nitro-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-ol.
| Compound Name | (3aR,4S,7S,7aS)-2,2,4-trimethyl-6-nitro-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-ol |
|---|---|
| PubChem CID | 134895585 |
| Molecular Formula | C9H15NO6 |
| Molecular Weight | 233.22 g/mol |
| Exact Mass | 233.09 |
| IUPAC Name | (3aR,4S,7S,7aS)-2,2,4-trimethyl-6-nitro-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-ol |
| SMILES | C[C@@H]1OC([N+](=O)[O-])[C@@H](O)[C@@H]2OC(C)(C)O[C@@H]21 |
| InChI | InChI=1S/C9H15NO6/c1-4-6-7(16-9(2,3)15-6)5(11)8(14-4)10(12)13/h4-8,11H,1-3H3/t4-,5-,6+,7-,8?/m0/s1 |
| InChIKey | VPAUXEJOGVPKGS-YTWDBIDXSA-N |
| XLogP | -0.11 |
| TPSA | 91.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.22 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|