C9H16O6 — CID 10398539
(3aR,4S,5R,6R,7R,7aS)-2,2-dimethyl-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxole-4,5,6,7-tetrol (PubChem CID 10398539) has the molecular formula C9H16O6 and a molecular weight of 220.22 g/mol. Its IUPAC name is (3aR,4S,5R,6R,7R,7aS)-2,2-dimethyl-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxole-4,5,6,7-tetrol.
| Compound Name | (3aR,4S,5R,6R,7R,7aS)-2,2-dimethyl-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxole-4,5,6,7-tetrol |
|---|---|
| PubChem CID | 10398539 |
| Molecular Formula | C9H16O6 |
| Molecular Weight | 220.22 g/mol |
| Exact Mass | 220.09 |
| IUPAC Name | (3aR,4S,5R,6R,7R,7aS)-2,2-dimethyl-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxole-4,5,6,7-tetrol |
| SMILES | CC1(C)O[C@@H]2[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O)[C@@H]2O1 |
| InChI | InChI=1S/C9H16O6/c1-9(2)14-7-5(12)3(10)4(11)6(13)8(7)15-9/h3-8,10-13H,1-2H3/t3-,4-,5-,6+,7+,8-/m1/s1 |
| InChIKey | RUICEADCEITZAL-ICCZOJKTSA-N |
| XLogP | -2.04 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.22 |
| LogP ≤ 5 | -2.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |