C12H22O5 — CID 10824321
(3aR,4S,5R,6R,6aS)-6-(2-hydroxy-2-methylpropyl)-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxole-4,5-diol (PubChem CID 10824321) has the molecular formula C12H22O5 and a molecular weight of 246.30 g/mol. Its IUPAC name is (3aR,4S,5R,6R,6aS)-6-(2-hydroxy-2-methylpropyl)-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxole-4,5-diol.
| Compound Name | (3aR,4S,5R,6R,6aS)-6-(2-hydroxy-2-methylpropyl)-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxole-4,5-diol |
|---|---|
| PubChem CID | 10824321 |
| Molecular Formula | C12H22O5 |
| Molecular Weight | 246.30 g/mol |
| Exact Mass | 246.15 |
| IUPAC Name | (3aR,4S,5R,6R,6aS)-6-(2-hydroxy-2-methylpropyl)-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxole-4,5-diol |
| SMILES | CC(C)(O)C[C@@H]1[C@@H](O)[C@H](O)[C@H]2OC(C)(C)O[C@@H]12 |
| InChI | InChI=1S/C12H22O5/c1-11(2,15)5-6-7(13)8(14)10-9(6)16-12(3,4)17-10/h6-10,13-15H,5H2,1-4H3/t6-,7-,8+,9+,10-/m1/s1 |
| InChIKey | CWFJCPHGCOWOFU-FHNUBNKASA-N |
| XLogP | 0.02 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.30 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |