C9H15ClO5 — CID 22826240
(3aR,5S,6S,7R,7aR)-5-(chloromethyl)-2,2-dimethyl-5,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-b]pyran-6,7-diol (PubChem CID 22826240) has the molecular formula C9H15ClO5 and a molecular weight of 238.67 g/mol. Its IUPAC name is (3aR,5S,6S,7R,7aR)-5-(chloromethyl)-2,2-dimethyl-5,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-b]pyran-6,7-diol.
| Compound Name | (3aR,5S,6S,7R,7aR)-5-(chloromethyl)-2,2-dimethyl-5,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-b]pyran-6,7-diol |
|---|---|
| PubChem CID | 22826240 |
| Molecular Formula | C9H15ClO5 |
| Molecular Weight | 238.67 g/mol |
| Exact Mass | 238.06 |
| IUPAC Name | (3aR,5S,6S,7R,7aR)-5-(chloromethyl)-2,2-dimethyl-5,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-b]pyran-6,7-diol |
| SMILES | CC1(C)O[C@H]2O[C@H](CCl)[C@@H](O)[C@@H](O)[C@H]2O1 |
| InChI | InChI=1S/C9H15ClO5/c1-9(2)14-7-6(12)5(11)4(3-10)13-8(7)15-9/h4-8,11-12H,3H2,1-2H3/t4-,5-,6-,7-,8-/m1/s1 |
| InChIKey | ZPMKKGGQOKRAGA-FMDGEEDCSA-N |
| XLogP | -0.18 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.67 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|