C13H24O4S — CID 54528686
(3aS,4R,5R,7R,8R,8aS)-5,7-diethyl-2,2-dimethyl-3a,4,5,7,8,8a-hexahydrothiepino[4,5-d][1,3]dioxole-4,8-diol (PubChem CID 54528686) has the molecular formula C13H24O4S and a molecular weight of 276.40 g/mol. Its IUPAC name is (3aS,4R,5R,7R,8R,8aS)-5,7-diethyl-2,2-dimethyl-3a,4,5,7,8,8a-hexahydrothiepino[4,5-d][1,3]dioxole-4,8-diol.
| Compound Name | (3aS,4R,5R,7R,8R,8aS)-5,7-diethyl-2,2-dimethyl-3a,4,5,7,8,8a-hexahydrothiepino[4,5-d][1,3]dioxole-4,8-diol |
|---|---|
| PubChem CID | 54528686 |
| Molecular Formula | C13H24O4S |
| Molecular Weight | 276.40 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | (3aS,4R,5R,7R,8R,8aS)-5,7-diethyl-2,2-dimethyl-3a,4,5,7,8,8a-hexahydrothiepino[4,5-d][1,3]dioxole-4,8-diol |
| SMILES | CC[C@H]1S[C@H](CC)[C@H](O)[C@@H]2OC(C)(C)O[C@H]2[C@H]1O |
| InChI | InChI=1S/C13H24O4S/c1-5-7-9(14)11-12(17-13(3,4)16-11)10(15)8(6-2)18-7/h7-12,14-15H,5-6H2,1-4H3/t7-,8-,9+,10+,11+,12+/m1/s1 |
| InChIKey | YUYLEMXMUZAVSF-HAVMIZHYSA-N |
| XLogP | 1.53 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.40 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |