C9H15NO3 — CID 58682836
(3aS,4R)-4-ethyl-2,2-dimethyl-5-oxido-4,6a-dihydro-3aH-[1,3]dioxolo[4,5-c]pyrrol-5-ium (PubChem CID 58682836) has the molecular formula C9H15NO3 and a molecular weight of 185.22 g/mol. Its IUPAC name is (3aS,4R)-4-ethyl-2,2-dimethyl-5-oxido-4,6a-dihydro-3aH-[1,3]dioxolo[4,5-c]pyrrol-5-ium.
| Compound Name | (3aS,4R)-4-ethyl-2,2-dimethyl-5-oxido-4,6a-dihydro-3aH-[1,3]dioxolo[4,5-c]pyrrol-5-ium |
|---|---|
| PubChem CID | 58682836 |
| Molecular Formula | C9H15NO3 |
| Molecular Weight | 185.22 g/mol |
| Exact Mass | 185.11 |
| IUPAC Name | (3aS,4R)-4-ethyl-2,2-dimethyl-5-oxido-4,6a-dihydro-3aH-[1,3]dioxolo[4,5-c]pyrrol-5-ium |
| SMILES | CC[C@@H]1[C@@H]2OC(C)(C)OC2C=[N+]1[O-] |
| InChI | InChI=1S/C9H15NO3/c1-4-6-8-7(5-10(6)11)12-9(2,3)13-8/h5-8H,4H2,1-3H3/t6-,7?,8+/m1/s1 |
| InChIKey | SLMVMULNEOGZCD-QUFPSDLASA-N |
| XLogP | 0.88 |
| TPSA | 44.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.22 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|