C8H12BrNO3 — CID 102383205
(3aR,4R,6aS)-4-(bromomethyl)-2,2-dimethyl-5-oxido-4,6a-dihydro-3aH-[1,3]dioxolo[4,5-c]pyrrol-5-ium (PubChem CID 102383205) has the molecular formula C8H12BrNO3 and a molecular weight of 250.09 g/mol. Its IUPAC name is (3aR,4R,6aS)-4-(bromomethyl)-2,2-dimethyl-5-oxido-4,6a-dihydro-3aH-[1,3]dioxolo[4,5-c]pyrrol-5-ium.
| Compound Name | (3aR,4R,6aS)-4-(bromomethyl)-2,2-dimethyl-5-oxido-4,6a-dihydro-3aH-[1,3]dioxolo[4,5-c]pyrrol-5-ium |
|---|---|
| PubChem CID | 102383205 |
| Molecular Formula | C8H12BrNO3 |
| Molecular Weight | 250.09 g/mol |
| Exact Mass | 249.00 |
| IUPAC Name | (3aR,4R,6aS)-4-(bromomethyl)-2,2-dimethyl-5-oxido-4,6a-dihydro-3aH-[1,3]dioxolo[4,5-c]pyrrol-5-ium |
| SMILES | CC1(C)O[C@H]2[C@H](C=[N+]([O-])[C@H]2CBr)O1 |
| InChI | InChI=1S/C8H12BrNO3/c1-8(2)12-6-4-10(11)5(3-9)7(6)13-8/h4-7H,3H2,1-2H3/t5-,6-,7+/m0/s1 |
| InChIKey | XXHQCEGGLWKCSS-LYFYHCNISA-N |
| XLogP | 0.86 |
| TPSA | 44.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.09 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|