C7H13BrO2 — CID 12741636
(4R,5S)-4-(bromomethyl)-2,2,5-trimethyl-1,3-dioxolane (PubChem CID 12741636) has the molecular formula C7H13BrO2 and a molecular weight of 209.08 g/mol. Its IUPAC name is (4R,5S)-4-(bromomethyl)-2,2,5-trimethyl-1,3-dioxolane.
| Compound Name | (4R,5S)-4-(bromomethyl)-2,2,5-trimethyl-1,3-dioxolane |
|---|---|
| PubChem CID | 12741636 |
| Molecular Formula | C7H13BrO2 |
| Molecular Weight | 209.08 g/mol |
| Exact Mass | 208.01 |
| IUPAC Name | (4R,5S)-4-(bromomethyl)-2,2,5-trimethyl-1,3-dioxolane |
| SMILES | C[C@@H]1OC(C)(C)O[C@H]1CBr |
| InChI | InChI=1S/C7H13BrO2/c1-5-6(4-8)10-7(2,3)9-5/h5-6H,4H2,1-3H3/t5-,6-/m0/s1 |
| InChIKey | OVDSWXQELIIFHU-WDSKDSINSA-N |
| XLogP | 1.92 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.08 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|