C13H24O6 — CID 166127175
(2,2,5,5,7,9a-hexamethyl-7,8-dihydro-3aH-[1,3]dioxolo[4,5-d][1,3,6]trioxocin-8-yl)methanol (PubChem CID 166127175) has the molecular formula C13H24O6 and a molecular weight of 276.33 g/mol. Its IUPAC name is (2,2,5,5,7,9a-hexamethyl-7,8-dihydro-3aH-[1,3]dioxolo[4,5-d][1,3,6]trioxocin-8-yl)methanol.
| Compound Name | (2,2,5,5,7,9a-hexamethyl-7,8-dihydro-3aH-[1,3]dioxolo[4,5-d][1,3,6]trioxocin-8-yl)methanol |
|---|---|
| PubChem CID | 166127175 |
| Molecular Formula | C13H24O6 |
| Molecular Weight | 276.33 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | (2,2,5,5,7,9a-hexamethyl-7,8-dihydro-3aH-[1,3]dioxolo[4,5-d][1,3,6]trioxocin-8-yl)methanol |
| SMILES | CC1OC(C)(C)OC2OC(C)(C)OC2(C)OC1CO |
| InChI | InChI=1S/C13H24O6/c1-8-9(7-14)16-13(6)10(17-11(2,3)15-8)18-12(4,5)19-13/h8-10,14H,7H2,1-6H3 |
| InChIKey | DGJWPAPZZXFVEU-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.33 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |