C9H16O4 — CID 143157562
[(3aS,6aR)-2,2,3a-trimethyl-6,6a-dihydro-4H-furo[3,4-d][1,3]dioxol-6-yl]methanol (PubChem CID 143157562) has the molecular formula C9H16O4 and a molecular weight of 188.22 g/mol. Its IUPAC name is [(3aS,6aR)-2,2,3a-trimethyl-6,6a-dihydro-4H-furo[3,4-d][1,3]dioxol-6-yl]methanol.
| Compound Name | [(3aS,6aR)-2,2,3a-trimethyl-6,6a-dihydro-4H-furo[3,4-d][1,3]dioxol-6-yl]methanol |
|---|---|
| PubChem CID | 143157562 |
| Molecular Formula | C9H16O4 |
| Molecular Weight | 188.22 g/mol |
| Exact Mass | 188.10 |
| IUPAC Name | [(3aS,6aR)-2,2,3a-trimethyl-6,6a-dihydro-4H-furo[3,4-d][1,3]dioxol-6-yl]methanol |
| SMILES | CC1(C)O[C@@H]2C(CO)OC[C@]2(C)O1 |
| InChI | InChI=1S/C9H16O4/c1-8(2)12-7-6(4-10)11-5-9(7,3)13-8/h6-7,10H,4-5H2,1-3H3/t6?,7-,9+/m1/s1 |
| InChIKey | JVNCHUCMRDXUDQ-HEWOVZETSA-N |
| XLogP | 0.29 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.22 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |