C9H16O6 — CID 45039611
(3aS,5S,6aR)-3a,5-bis(hydroxymethyl)-2,2-dimethyl-6,6a-dihydro-5H-furo[2,3-d][1,3]dioxol-6-ol (PubChem CID 45039611) has the molecular formula C9H16O6 and a molecular weight of 220.22 g/mol. Its IUPAC name is (3aS,5S,6aR)-3a,5-bis(hydroxymethyl)-2,2-dimethyl-6,6a-dihydro-5H-furo[2,3-d][1,3]dioxol-6-ol.
| Compound Name | (3aS,5S,6aR)-3a,5-bis(hydroxymethyl)-2,2-dimethyl-6,6a-dihydro-5H-furo[2,3-d][1,3]dioxol-6-ol |
|---|---|
| PubChem CID | 45039611 |
| Molecular Formula | C9H16O6 |
| Molecular Weight | 220.22 g/mol |
| Exact Mass | 220.09 |
| IUPAC Name | (3aS,5S,6aR)-3a,5-bis(hydroxymethyl)-2,2-dimethyl-6,6a-dihydro-5H-furo[2,3-d][1,3]dioxol-6-ol |
| SMILES | CC1(C)O[C@@H]2C(O)[C@H](CO)O[C@@]2(CO)O1 |
| InChI | InChI=1S/C9H16O6/c1-8(2)14-7-6(12)5(3-10)13-9(7,4-11)15-8/h5-7,10-12H,3-4H2,1-2H3/t5-,6?,7+,9-/m0/s1 |
| InChIKey | AVVCILZWWPKOLD-FTTNTJTMSA-N |
| XLogP | -1.42 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.22 |
| LogP ≤ 5 | -1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |