C18H26O6 — CID 10860699
(3aS,5S,6R,6aS)-5-(hydroxymethyl)-2,2-dimethyl-3a-(3-phenylmethoxypropyl)-6,6a-dihydro-5H-furo[2,3-d][1,3]dioxol-6-ol (PubChem CID 10860699) has the molecular formula C18H26O6 and a molecular weight of 338.40 g/mol. Its IUPAC name is (3aS,5S,6R,6aS)-5-(hydroxymethyl)-2,2-dimethyl-3a-(3-phenylmethoxypropyl)-6,6a-dihydro-5H-furo[2,3-d][1,3]dioxol-6-ol.
| Compound Name | (3aS,5S,6R,6aS)-5-(hydroxymethyl)-2,2-dimethyl-3a-(3-phenylmethoxypropyl)-6,6a-dihydro-5H-furo[2,3-d][1,3]dioxol-6-ol |
|---|---|
| PubChem CID | 10860699 |
| Molecular Formula | C18H26O6 |
| Molecular Weight | 338.40 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | (3aS,5S,6R,6aS)-5-(hydroxymethyl)-2,2-dimethyl-3a-(3-phenylmethoxypropyl)-6,6a-dihydro-5H-furo[2,3-d][1,3]dioxol-6-ol |
| SMILES | CC1(C)O[C@H]2[C@H](O)[C@H](CO)O[C@@]2(CCCOCc2ccccc2)O1 |
| InChI | InChI=1S/C18H26O6/c1-17(2)23-16-15(20)14(11-19)22-18(16,24-17)9-6-10-21-12-13-7-4-3-5-8-13/h3-5,7-8,14-16,19-20H,6,9-12H2,1-2H3/t14-,15+,16-,18-/m0/s1 |
| InChIKey | KORGZGUSEHZOCY-DFGXFYAUSA-N |
| XLogP | 1.58 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.40 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|