C21H32O4 — CID 11371480
[(2R,3S,6S,8R,9S)-3,9-dimethyl-8-(2-phenylmethoxyethyl)-1,7-dioxaspiro[5.5]undecan-2-yl]methanol (PubChem CID 11371480) has the molecular formula C21H32O4 and a molecular weight of 348.48 g/mol. Its IUPAC name is [(2R,3S,6S,8R,9S)-3,9-dimethyl-8-(2-phenylmethoxyethyl)-1,7-dioxaspiro[5.5]undecan-2-yl]methanol.
| Compound Name | [(2R,3S,6S,8R,9S)-3,9-dimethyl-8-(2-phenylmethoxyethyl)-1,7-dioxaspiro[5.5]undecan-2-yl]methanol |
|---|---|
| PubChem CID | 11371480 |
| Molecular Formula | C21H32O4 |
| Molecular Weight | 348.48 g/mol |
| Exact Mass | 348.23 |
| IUPAC Name | [(2R,3S,6S,8R,9S)-3,9-dimethyl-8-(2-phenylmethoxyethyl)-1,7-dioxaspiro[5.5]undecan-2-yl]methanol |
| SMILES | C[C@H]1CC[C@]2(CC[C@H](C)[C@@H](CCOCc3ccccc3)O2)O[C@H]1CO |
| InChI | InChI=1S/C21H32O4/c1-16-8-11-21(12-9-17(2)20(14-22)25-21)24-19(16)10-13-23-15-18-6-4-3-5-7-18/h3-7,16-17,19-20,22H,8-15H2,1-2H3/t16-,17-,19+,20-,21-/m0/s1 |
| InChIKey | UWQDMOKPSCYEFR-WJRACZLCSA-N |
| XLogP | 3.91 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.48 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|