C39H50O7 — CID 102590695
[(2S,3S,6R,8S,9R,10S)-2-[(2R)-2-[(4-methoxyphenyl)methoxy]butyl]-3,9-dimethyl-8-(2-phenylmethoxyethyl)-1,7-dioxaspiro[5.5]undecan-10-yl] benzoate (PubChem CID 102590695) has the molecular formula C39H50O7 and a molecular weight of 630.82 g/mol. Its IUPAC name is [(2S,3S,6R,8S,9R,10S)-2-[(2R)-2-[(4-methoxyphenyl)methoxy]butyl]-3,9-dimethyl-8-(2-phenylmethoxyethyl)-1,7-dioxaspiro[5.5]undecan-10-yl] benzoate.
| Compound Name | [(2S,3S,6R,8S,9R,10S)-2-[(2R)-2-[(4-methoxyphenyl)methoxy]butyl]-3,9-dimethyl-8-(2-phenylmethoxyethyl)-1,7-dioxaspiro[5.5]undecan-10-yl] benzoate |
|---|---|
| PubChem CID | 102590695 |
| Molecular Formula | C39H50O7 |
| Molecular Weight | 630.82 g/mol |
| Exact Mass | 630.36 |
| IUPAC Name | [(2S,3S,6R,8S,9R,10S)-2-[(2R)-2-[(4-methoxyphenyl)methoxy]butyl]-3,9-dimethyl-8-(2-phenylmethoxyethyl)-1,7-dioxaspiro[5.5]undecan-10-yl] benzoate |
| SMILES | CC[C@H](C[C@@H]1O[C@@]2(CC[C@@H]1C)C[C@H](OC(=O)c1ccccc1)[C@H](C)[C@H](CCOCc1ccccc1)O2)OCc1ccc(OC)cc1 |
| InChI | InChI=1S/C39H50O7/c1-5-33(43-27-31-16-18-34(41-4)19-17-31)24-36-28(2)20-22-39(46-36)25-37(44-38(40)32-14-10-7-11-15-32)29(3)35(45-39)21-23-42-26-30-12-8-6-9-13-30/h6-19,28-29,33,35-37H,5,20-27H2,1-4H3/t28-,29+,33+,35-,36-,37-,39-/m0/s1 |
| InChIKey | HSBKRLLFCFTSGR-YECCBIOZSA-N |
| XLogP | 8.15 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.82 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|