C27H34O7 — CID 91502233
[1-[(4S,5S)-5-(2-hydroxyethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-5-[(4-methoxyphenyl)methoxy]pent-2-enyl] benzoate (PubChem CID 91502233) has the molecular formula C27H34O7 and a molecular weight of 470.56 g/mol. Its IUPAC name is [1-[(4S,5S)-5-(2-hydroxyethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-5-[(4-methoxyphenyl)methoxy]pent-2-enyl] benzoate.
| Compound Name | [1-[(4S,5S)-5-(2-hydroxyethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-5-[(4-methoxyphenyl)methoxy]pent-2-enyl] benzoate |
|---|---|
| PubChem CID | 91502233 |
| Molecular Formula | C27H34O7 |
| Molecular Weight | 470.56 g/mol |
| Exact Mass | 470.23 |
| IUPAC Name | [1-[(4S,5S)-5-(2-hydroxyethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-5-[(4-methoxyphenyl)methoxy]pent-2-enyl] benzoate |
| SMILES | COc1ccc(COCCC=CC(OC(=O)c2ccccc2)[C@H]2OC(C)(C)O[C@H]2CCO)cc1 |
| InChI | InChI=1S/C27H34O7/c1-27(2)33-24(16-17-28)25(34-27)23(32-26(29)21-9-5-4-6-10-21)11-7-8-18-31-19-20-12-14-22(30-3)15-13-20/h4-7,9-15,23-25,28H,8,16-19H2,1-3H3/t23?,24-,25+/m0/s1 |
| InChIKey | FZBJAVGWICATBN-NCPLZGKYSA-N |
| XLogP | 4.29 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.56 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|