C30H37IO6 — CID 91583617
[1-[5-(2-iodoethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-[(1R,2R)-2-[(4-methoxyphenyl)methoxy]cyclopentyl]prop-2-enyl] benzoate (PubChem CID 91583617) has the molecular formula C30H37IO6 and a molecular weight of 620.52 g/mol. Its IUPAC name is [1-[5-(2-iodoethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-[(1R,2R)-2-[(4-methoxyphenyl)methoxy]cyclopentyl]prop-2-enyl] benzoate.
| Compound Name | [1-[5-(2-iodoethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-[(1R,2R)-2-[(4-methoxyphenyl)methoxy]cyclopentyl]prop-2-enyl] benzoate |
|---|---|
| PubChem CID | 91583617 |
| Molecular Formula | C30H37IO6 |
| Molecular Weight | 620.52 g/mol |
| Exact Mass | 620.16 |
| IUPAC Name | [1-[5-(2-iodoethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-[(1R,2R)-2-[(4-methoxyphenyl)methoxy]cyclopentyl]prop-2-enyl] benzoate |
| SMILES | COc1ccc(CO[C@@H]2CCC[C@@H]2C=CC(OC(=O)c2ccccc2)C2OC(C)(C)OC2CCI)cc1 |
| InChI | InChI=1S/C30H37IO6/c1-30(2)36-27(18-19-31)28(37-30)26(35-29(32)23-8-5-4-6-9-23)17-14-22-10-7-11-25(22)34-20-21-12-15-24(33-3)16-13-21/h4-6,8-9,12-17,22,25-28H,7,10-11,18-20H2,1-3H3/t22-,25-,26?,27?,28?/m1/s1 |
| InChIKey | LMOSLNOAEDTDSF-ZKJOBWDHSA-N |
| XLogP | 6.51 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.52 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|