C27H43IO5Si — CID 91461022
[(4R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-1-[(4S,5S)-5-(2-iodoethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-methylhex-2-enyl] benzoate (PubChem CID 91461022) has the molecular formula C27H43IO5Si and a molecular weight of 602.63 g/mol. Its IUPAC name is [(4R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-1-[(4S,5S)-5-(2-iodoethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-methylhex-2-enyl] benzoate.
| Compound Name | [(4R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-1-[(4S,5S)-5-(2-iodoethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-methylhex-2-enyl] benzoate |
|---|---|
| PubChem CID | 91461022 |
| Molecular Formula | C27H43IO5Si |
| Molecular Weight | 602.63 g/mol |
| Exact Mass | 602.19 |
| IUPAC Name | [(4R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-1-[(4S,5S)-5-(2-iodoethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-methylhex-2-enyl] benzoate |
| SMILES | C[C@H](C=CC(OC(=O)c1ccccc1)[C@H]1OC(C)(C)O[C@H]1CCI)[C@@H](C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H43IO5Si/c1-19(20(2)33-34(8,9)26(3,4)5)15-16-22(30-25(29)21-13-11-10-12-14-21)24-23(17-18-28)31-27(6,7)32-24/h10-16,19-20,22-24H,17-18H2,1-9H3/t19-,20-,22?,23+,24-/m1/s1 |
| InChIKey | CYYRURDOJLASDJ-YRROVBCYSA-N |
| XLogP | 7.16 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.63 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|