C36H57IO4Si2 — CID 59466687
tert-butyl-[(Z,2S,3S)-6-[tert-butyl(dimethyl)silyl]oxy-6-[(4S,5S)-5-(2-iodoethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-methylhex-4-en-2-yl]oxy-diphenylsilane (PubChem CID 59466687) has the molecular formula C36H57IO4Si2 and a molecular weight of 736.92 g/mol. Its IUPAC name is tert-butyl-[(Z,2S,3S)-6-[tert-butyl(dimethyl)silyl]oxy-6-[(4S,5S)-5-(2-iodoethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-methylhex-4-en-2-yl]oxy-diphenylsilane.
| Compound Name | tert-butyl-[(Z,2S,3S)-6-[tert-butyl(dimethyl)silyl]oxy-6-[(4S,5S)-5-(2-iodoethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-methylhex-4-en-2-yl]oxy-diphenylsilane |
|---|---|
| PubChem CID | 59466687 |
| Molecular Formula | C36H57IO4Si2 |
| Molecular Weight | 736.92 g/mol |
| Exact Mass | 736.28 |
| IUPAC Name | tert-butyl-[(Z,2S,3S)-6-[tert-butyl(dimethyl)silyl]oxy-6-[(4S,5S)-5-(2-iodoethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-methylhex-4-en-2-yl]oxy-diphenylsilane |
| SMILES | C[C@H](O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@@H](C)/C=C\C(O[Si](C)(C)C(C)(C)C)[C@H]1OC(C)(C)O[C@H]1CCI |
| InChI | InChI=1S/C36H57IO4Si2/c1-27(23-24-32(41-42(11,12)34(3,4)5)33-31(25-26-37)38-36(9,10)39-33)28(2)40-43(35(6,7)8,29-19-15-13-16-20-29)30-21-17-14-18-22-30/h13-24,27-28,31-33H,25-26H2,1-12H3/b24-23-/t27-,28-,31-,32?,33-/m0/s1 |
| InChIKey | PXYHRNFHHNUBQA-PSEXMHTRSA-N |
| XLogP | 8.88 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 736.92 |
| LogP ≤ 5 | 8.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|