C41H66O6Si2 — CID 88956836
2-[(4S,5S)-5-[(Z,4R,5S)-1-[tert-butyl(dimethyl)silyl]oxy-5-[tert-butyl(diphenyl)silyl]oxy-4-methylhex-2-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]ethyl 2,2-dimethylpropanoate (PubChem CID 88956836) has the molecular formula C41H66O6Si2 and a molecular weight of 711.15 g/mol. Its IUPAC name is 2-[(4S,5S)-5-[(Z,4R,5S)-1-[tert-butyl(dimethyl)silyl]oxy-5-[tert-butyl(diphenyl)silyl]oxy-4-methylhex-2-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]ethyl 2,2-dimethylpropanoate.
| Compound Name | 2-[(4S,5S)-5-[(Z,4R,5S)-1-[tert-butyl(dimethyl)silyl]oxy-5-[tert-butyl(diphenyl)silyl]oxy-4-methylhex-2-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]ethyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 88956836 |
| Molecular Formula | C41H66O6Si2 |
| Molecular Weight | 711.15 g/mol |
| Exact Mass | 710.44 |
| IUPAC Name | 2-[(4S,5S)-5-[(Z,4R,5S)-1-[tert-butyl(dimethyl)silyl]oxy-5-[tert-butyl(diphenyl)silyl]oxy-4-methylhex-2-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]ethyl 2,2-dimethylpropanoate |
| SMILES | C[C@H](/C=C\C(O[Si](C)(C)C(C)(C)C)[C@H]1OC(C)(C)O[C@H]1CCOC(=O)C(C)(C)C)[C@H](C)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C41H66O6Si2/c1-30(31(2)46-49(40(9,10)11,32-22-18-16-19-23-32)33-24-20-17-21-25-33)26-27-35(47-48(14,15)39(6,7)8)36-34(44-41(12,13)45-36)28-29-43-37(42)38(3,4)5/h16-27,30-31,34-36H,28-29H2,1-15H3/b27-26-/t30-,31+,34+,35?,36+/m1/s1 |
| InChIKey | AWJYCXGHADMMSL-KONKINAFSA-N |
| XLogP | 9.03 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.15 |
| LogP ≤ 5 | 9.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|