C35H50O6Si — CID 88956835
2-[(4S,5R)-5-[(4R,5S)-5-[tert-butyl(diphenyl)silyl]oxy-1-hydroxy-4-methylhex-2-ynyl]-2,2-dimethyl-1,3-dioxolan-4-yl]ethyl 2,2-dimethylpropanoate (PubChem CID 88956835) has the molecular formula C35H50O6Si and a molecular weight of 594.87 g/mol. Its IUPAC name is 2-[(4S,5R)-5-[(4R,5S)-5-[tert-butyl(diphenyl)silyl]oxy-1-hydroxy-4-methylhex-2-ynyl]-2,2-dimethyl-1,3-dioxolan-4-yl]ethyl 2,2-dimethylpropanoate.
| Compound Name | 2-[(4S,5R)-5-[(4R,5S)-5-[tert-butyl(diphenyl)silyl]oxy-1-hydroxy-4-methylhex-2-ynyl]-2,2-dimethyl-1,3-dioxolan-4-yl]ethyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 88956835 |
| Molecular Formula | C35H50O6Si |
| Molecular Weight | 594.87 g/mol |
| Exact Mass | 594.34 |
| IUPAC Name | 2-[(4S,5R)-5-[(4R,5S)-5-[tert-butyl(diphenyl)silyl]oxy-1-hydroxy-4-methylhex-2-ynyl]-2,2-dimethyl-1,3-dioxolan-4-yl]ethyl 2,2-dimethylpropanoate |
| SMILES | C[C@H](C#CC(O)[C@H]1OC(C)(C)O[C@H]1CCOC(=O)C(C)(C)C)[C@H](C)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C35H50O6Si/c1-25(21-22-29(36)31-30(39-35(9,10)40-31)23-24-38-32(37)33(3,4)5)26(2)41-42(34(6,7)8,27-17-13-11-14-18-27)28-19-15-12-16-20-28/h11-20,25-26,29-31,36H,23-24H2,1-10H3/t25-,26+,29?,30+,31-/m1/s1 |
| InChIKey | VVRZMIZNAOHMTB-RLPJGDSQSA-N |
| XLogP | 5.45 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.87 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|