C32H50O3Si — CID 58304583
tert-butyl-[(3R,6R)-6-[(5S)-2,2-dimethyl-5-propyl-1,3-dioxolan-4-yl]-3-methylheptan-2-yl]oxy-diphenylsilane (PubChem CID 58304583) has the molecular formula C32H50O3Si and a molecular weight of 510.84 g/mol. Its IUPAC name is tert-butyl-[(3R,6R)-6-[(5S)-2,2-dimethyl-5-propyl-1,3-dioxolan-4-yl]-3-methylheptan-2-yl]oxy-diphenylsilane.
| Compound Name | tert-butyl-[(3R,6R)-6-[(5S)-2,2-dimethyl-5-propyl-1,3-dioxolan-4-yl]-3-methylheptan-2-yl]oxy-diphenylsilane |
|---|---|
| PubChem CID | 58304583 |
| Molecular Formula | C32H50O3Si |
| Molecular Weight | 510.84 g/mol |
| Exact Mass | 510.35 |
| IUPAC Name | tert-butyl-[(3R,6R)-6-[(5S)-2,2-dimethyl-5-propyl-1,3-dioxolan-4-yl]-3-methylheptan-2-yl]oxy-diphenylsilane |
| SMILES | CCC[C@@H]1OC(C)(C)OC1[C@H](C)CC[C@@H](C)C(C)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C32H50O3Si/c1-10-17-29-30(34-32(8,9)33-29)25(3)23-22-24(2)26(4)35-36(31(5,6)7,27-18-13-11-14-19-27)28-20-15-12-16-21-28/h11-16,18-21,24-26,29-30H,10,17,22-23H2,1-9H3/t24-,25-,26?,29+,30?/m1/s1 |
| InChIKey | KLYCDUARMDJFQF-DRVROEFASA-N |
| XLogP | 7.32 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.84 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|