C29H43ClO3SiZn- — CID 101042348
CID 101042348 (PubChem CID 101042348) has the molecular formula C29H43ClO3SiZn- and a molecular weight of 568.59 g/mol.
| Compound Name | CID 101042348 |
|---|---|
| PubChem CID | 101042348 |
| Molecular Formula | C29H43ClO3SiZn- |
| Molecular Weight | 568.59 g/mol |
| Exact Mass | 566.20 |
| IUPAC Name | — |
| SMILES | [CH2][C@H](C)[C@@H]1OC(C)(C)O[C@H]([C@H](C)CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@@H]1C.[Cl-].[Zn] |
| InChI | InChI=1S/C29H43O3Si.ClH.Zn/c1-21(2)26-23(4)27(32-29(8,9)31-26)22(3)20-30-33(28(5,6)7,24-16-12-10-13-17-24)25-18-14-11-15-19-25;;/h10-19,21-23,26-27H,1,20H2,2-9H3;1H;/p-1/t21-,22-,23-,26+,27-;;/m1../s1 |
| InChIKey | YAHUFWGLLQBGCA-FGXXTUNKSA-M |
| XLogP | 2.83 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.59 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|