C40H58O4Si — CID 10886719
tert-butyl-[(2S,4S)-2-ethyl-4-[(4S,5R,6S)-2,2,5-trimethyl-6-[(2S)-1-phenylmethoxypropan-2-yl]-1,3-dioxan-4-yl]pentoxy]-diphenylsilane (PubChem CID 10886719) has the molecular formula C40H58O4Si and a molecular weight of 630.99 g/mol. Its IUPAC name is tert-butyl-[(2S,4S)-2-ethyl-4-[(4S,5R,6S)-2,2,5-trimethyl-6-[(2S)-1-phenylmethoxypropan-2-yl]-1,3-dioxan-4-yl]pentoxy]-diphenylsilane.
| Compound Name | tert-butyl-[(2S,4S)-2-ethyl-4-[(4S,5R,6S)-2,2,5-trimethyl-6-[(2S)-1-phenylmethoxypropan-2-yl]-1,3-dioxan-4-yl]pentoxy]-diphenylsilane |
|---|---|
| PubChem CID | 10886719 |
| Molecular Formula | C40H58O4Si |
| Molecular Weight | 630.99 g/mol |
| Exact Mass | 630.41 |
| IUPAC Name | tert-butyl-[(2S,4S)-2-ethyl-4-[(4S,5R,6S)-2,2,5-trimethyl-6-[(2S)-1-phenylmethoxypropan-2-yl]-1,3-dioxan-4-yl]pentoxy]-diphenylsilane |
| SMILES | CC[C@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)C[C@H](C)[C@@H]1OC(C)(C)O[C@@H]([C@@H](C)COCc2ccccc2)[C@@H]1C |
| InChI | InChI=1S/C40H58O4Si/c1-10-33(29-42-45(39(5,6)7,35-22-16-12-17-23-35)36-24-18-13-19-25-36)26-30(2)37-32(4)38(44-40(8,9)43-37)31(3)27-41-28-34-20-14-11-15-21-34/h11-25,30-33,37-38H,10,26-29H2,1-9H3/t30-,31-,32+,33-,37-,38-/m0/s1 |
| InChIKey | JTGSATMEDLVJBY-SYZDZSLNSA-N |
| XLogP | 8.62 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.99 |
| LogP ≤ 5 | 8.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|