C35H56N2O3Si — CID 135773452
N-[(E)-[(3S)-3-[(4S,5R,6S)-6-[(3S)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]pentyl]-2,2,5-trimethyl-1,3-dioxan-4-yl]butan-2-ylidene]amino]-N-methylmethanamine (PubChem CID 135773452) has the molecular formula C35H56N2O3Si and a molecular weight of 580.93 g/mol. Its IUPAC name is N-[(E)-[(3S)-3-[(4S,5R,6S)-6-[(3S)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]pentyl]-2,2,5-trimethyl-1,3-dioxan-4-yl]butan-2-ylidene]amino]-N-methylmethanamine.
| Compound Name | N-[(E)-[(3S)-3-[(4S,5R,6S)-6-[(3S)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]pentyl]-2,2,5-trimethyl-1,3-dioxan-4-yl]butan-2-ylidene]amino]-N-methylmethanamine |
|---|---|
| PubChem CID | 135773452 |
| Molecular Formula | C35H56N2O3Si |
| Molecular Weight | 580.93 g/mol |
| Exact Mass | 580.41 |
| IUPAC Name | N-[(E)-[(3S)-3-[(4S,5R,6S)-6-[(3S)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]pentyl]-2,2,5-trimethyl-1,3-dioxan-4-yl]butan-2-ylidene]amino]-N-methylmethanamine |
| SMILES | CC[C@@H](CC[C@@H]1OC(C)(C)O[C@@H]([C@@H](C)/C(C)=N/N(C)C)[C@@H]1C)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C35H56N2O3Si/c1-12-29(23-24-32-27(3)33(40-35(8,9)39-32)26(2)28(4)36-37(10)11)25-38-41(34(5,6)7,30-19-15-13-16-20-30)31-21-17-14-18-22-31/h13-22,26-27,29,32-33H,12,23-25H2,1-11H3/b36-28+/t26-,27+,29-,32-,33-/m0/s1 |
| InChIKey | COEBAROTHGLXMG-REDJFZCBSA-N |
| XLogP | 7.10 |
| TPSA | 43.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.93 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|