C27H32O3Si — CID 11201317
(2S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-phenylmethoxypropanal (PubChem CID 11201317) has the molecular formula C27H32O3Si and a molecular weight of 432.64 g/mol. Its IUPAC name is (2S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-phenylmethoxypropanal.
| Compound Name | (2S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-phenylmethoxypropanal |
|---|---|
| PubChem CID | 11201317 |
| Molecular Formula | C27H32O3Si |
| Molecular Weight | 432.64 g/mol |
| Exact Mass | 432.21 |
| IUPAC Name | (2S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-phenylmethoxypropanal |
| SMILES | CC(C)(C)[Si](OC[C@@H](C=O)COCc1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H32O3Si/c1-27(2,3)31(25-15-9-5-10-16-25,26-17-11-6-12-18-26)30-22-24(19-28)21-29-20-23-13-7-4-8-14-23/h4-19,24H,20-22H2,1-3H3/t24-/m0/s1 |
| InChIKey | LDOWOTVWCFXEMJ-DEOSSOPVSA-N |
| XLogP | 4.59 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.64 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|