C32H40O6Si — CID 11038911
(Z,2R,7R)-8-[tert-butyl(diphenyl)silyl]oxy-7-hydroxy-2-(phenylmethoxymethoxy)oct-4-enoic acid (PubChem CID 11038911) has the molecular formula C32H40O6Si and a molecular weight of 548.75 g/mol. Its IUPAC name is (Z,2R,7R)-8-[tert-butyl(diphenyl)silyl]oxy-7-hydroxy-2-(phenylmethoxymethoxy)oct-4-enoic acid.
| Compound Name | (Z,2R,7R)-8-[tert-butyl(diphenyl)silyl]oxy-7-hydroxy-2-(phenylmethoxymethoxy)oct-4-enoic acid |
|---|---|
| PubChem CID | 11038911 |
| Molecular Formula | C32H40O6Si |
| Molecular Weight | 548.75 g/mol |
| Exact Mass | 548.26 |
| IUPAC Name | (Z,2R,7R)-8-[tert-butyl(diphenyl)silyl]oxy-7-hydroxy-2-(phenylmethoxymethoxy)oct-4-enoic acid |
| SMILES | CC(C)(C)[Si](OC[C@H](O)C/C=C\C[C@@H](OCOCc1ccccc1)C(=O)O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C32H40O6Si/c1-32(2,3)39(28-18-9-5-10-19-28,29-20-11-6-12-21-29)38-24-27(33)17-13-14-22-30(31(34)35)37-25-36-23-26-15-7-4-8-16-26/h4-16,18-21,27,30,33H,17,22-25H2,1-3H3,(H,34,35)/b14-13-/t27-,30-/m1/s1 |
| InChIKey | SEMIYBCUWAZDPG-RTHRXZRESA-N |
| XLogP | 4.90 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.75 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|