C36H52O4Si — CID 101267153
(3R,5S,7S,8S)-9-[tert-butyl(diphenyl)silyl]oxy-3,5,7-trimethyl-8-(phenylmethoxymethoxy)nonan-1-ol (PubChem CID 101267153) has the molecular formula C36H52O4Si and a molecular weight of 576.89 g/mol. Its IUPAC name is (3R,5S,7S,8S)-9-[tert-butyl(diphenyl)silyl]oxy-3,5,7-trimethyl-8-(phenylmethoxymethoxy)nonan-1-ol.
| Compound Name | (3R,5S,7S,8S)-9-[tert-butyl(diphenyl)silyl]oxy-3,5,7-trimethyl-8-(phenylmethoxymethoxy)nonan-1-ol |
|---|---|
| PubChem CID | 101267153 |
| Molecular Formula | C36H52O4Si |
| Molecular Weight | 576.89 g/mol |
| Exact Mass | 576.36 |
| IUPAC Name | (3R,5S,7S,8S)-9-[tert-butyl(diphenyl)silyl]oxy-3,5,7-trimethyl-8-(phenylmethoxymethoxy)nonan-1-ol |
| SMILES | C[C@@H](CCO)C[C@H](C)C[C@H](C)[C@@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)OCOCc1ccccc1 |
| InChI | InChI=1S/C36H52O4Si/c1-29(22-23-37)24-30(2)25-31(3)35(39-28-38-26-32-16-10-7-11-17-32)27-40-41(36(4,5)6,33-18-12-8-13-19-33)34-20-14-9-15-21-34/h7-21,29-31,35,37H,22-28H2,1-6H3/t29-,30-,31-,35+/m0/s1 |
| InChIKey | NWZKIRQHSBBSIL-WYODCFETSA-N |
| XLogP | 7.19 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.89 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|