C34H46O5Si — CID 100990271
tert-butyl (2R,3S)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-methyl-4-(phenylmethoxymethoxy)butanoate (PubChem CID 100990271) has the molecular formula C34H46O5Si and a molecular weight of 562.82 g/mol. Its IUPAC name is tert-butyl (2R,3S)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-methyl-4-(phenylmethoxymethoxy)butanoate.
| Compound Name | tert-butyl (2R,3S)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-methyl-4-(phenylmethoxymethoxy)butanoate |
|---|---|
| PubChem CID | 100990271 |
| Molecular Formula | C34H46O5Si |
| Molecular Weight | 562.82 g/mol |
| Exact Mass | 562.31 |
| IUPAC Name | tert-butyl (2R,3S)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-methyl-4-(phenylmethoxymethoxy)butanoate |
| SMILES | C[C@@H](C(=O)OC(C)(C)C)[C@@H](COCOCc1ccccc1)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C34H46O5Si/c1-27(32(35)39-33(2,3)4)29(24-37-26-36-23-28-17-11-8-12-18-28)25-38-40(34(5,6)7,30-19-13-9-14-20-30)31-21-15-10-16-22-31/h8-22,27,29H,23-26H2,1-7H3/t27-,29+/m1/s1 |
| InChIKey | YDEGXYKFAYUWJM-PXJZQJOASA-N |
| XLogP | 6.35 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.82 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|