C31H38O6Si — CID 140825986
[(2S,3R)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-formyloxy-2-(phenylmethoxymethyl)butyl] formate (PubChem CID 140825986) has the molecular formula C31H38O6Si and a molecular weight of 534.73 g/mol. Its IUPAC name is [(2S,3R)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-formyloxy-2-(phenylmethoxymethyl)butyl] formate.
| Compound Name | [(2S,3R)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-formyloxy-2-(phenylmethoxymethyl)butyl] formate |
|---|---|
| PubChem CID | 140825986 |
| Molecular Formula | C31H38O6Si |
| Molecular Weight | 534.73 g/mol |
| Exact Mass | 534.24 |
| IUPAC Name | [(2S,3R)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-formyloxy-2-(phenylmethoxymethyl)butyl] formate |
| SMILES | CC(C)(C)[Si](OC[C@@H](COC=O)[C@H](COC=O)COCc1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H38O6Si/c1-31(2,3)38(29-15-9-5-10-16-29,30-17-11-6-12-18-30)37-23-28(22-36-25-33)27(21-35-24-32)20-34-19-26-13-7-4-8-14-26/h4-18,24-25,27-28H,19-23H2,1-3H3/t27-,28+/m0/s1 |
| InChIKey | KDFYWHGLJRZOBH-WUFINQPMSA-N |
| XLogP | 4.36 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.73 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|