C44H66O6Si — CID 11468214
[(2R,3S,5R,7S,9S,10S)-11-[tert-butyl(diphenyl)silyl]oxy-2-hydroxy-3,5,7,9-tetramethyl-10-(phenylmethoxymethoxy)undecyl] 2,2-dimethylpropanoate (PubChem CID 11468214) has the molecular formula C44H66O6Si and a molecular weight of 719.09 g/mol. Its IUPAC name is [(2R,3S,5R,7S,9S,10S)-11-[tert-butyl(diphenyl)silyl]oxy-2-hydroxy-3,5,7,9-tetramethyl-10-(phenylmethoxymethoxy)undecyl] 2,2-dimethylpropanoate.
| Compound Name | [(2R,3S,5R,7S,9S,10S)-11-[tert-butyl(diphenyl)silyl]oxy-2-hydroxy-3,5,7,9-tetramethyl-10-(phenylmethoxymethoxy)undecyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 11468214 |
| Molecular Formula | C44H66O6Si |
| Molecular Weight | 719.09 g/mol |
| Exact Mass | 718.46 |
| IUPAC Name | [(2R,3S,5R,7S,9S,10S)-11-[tert-butyl(diphenyl)silyl]oxy-2-hydroxy-3,5,7,9-tetramethyl-10-(phenylmethoxymethoxy)undecyl] 2,2-dimethylpropanoate |
| SMILES | C[C@H](C[C@H](C)C[C@H](C)[C@@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)OCOCc1ccccc1)C[C@H](C)[C@@H](O)COC(=O)C(C)(C)C |
| InChI | InChI=1S/C44H66O6Si/c1-33(27-35(3)40(45)30-48-42(46)43(5,6)7)26-34(2)28-36(4)41(49-32-47-29-37-20-14-11-15-21-37)31-50-51(44(8,9)10,38-22-16-12-17-23-38)39-24-18-13-19-25-39/h11-25,33-36,40-41,45H,26-32H2,1-10H3/t33-,34+,35+,36+,40+,41-/m1/s1 |
| InChIKey | HAIVGUCODYMNBE-ZIDQLIMMSA-N |
| XLogP | 8.79 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.09 |
| LogP ≤ 5 | 8.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|