C26H29ClO2Si — CID 156904158
2-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-(4-chlorophenyl)propanal (PubChem CID 156904158) has the molecular formula C26H29ClO2Si and a molecular weight of 437.06 g/mol. Its IUPAC name is 2-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-(4-chlorophenyl)propanal.
| Compound Name | 2-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-(4-chlorophenyl)propanal |
|---|---|
| PubChem CID | 156904158 |
| Molecular Formula | C26H29ClO2Si |
| Molecular Weight | 437.06 g/mol |
| Exact Mass | 436.16 |
| IUPAC Name | 2-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-(4-chlorophenyl)propanal |
| SMILES | CC(C)(C)[Si](OCC(C=O)Cc1ccc(Cl)cc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H29ClO2Si/c1-26(2,3)30(24-10-6-4-7-11-24,25-12-8-5-9-13-25)29-20-22(19-28)18-21-14-16-23(27)17-15-21/h4-17,19,22H,18,20H2,1-3H3 |
| InChIKey | MJKCSUMATGTZFT-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.06 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|