C41H49NO2Si2 — CID 11700207
(2S)-1-[tert-butyl(diphenyl)silyl]oxy-3-[4-[tert-butyl(diphenyl)silyl]oxyphenyl]propan-2-amine (PubChem CID 11700207) has the molecular formula C41H49NO2Si2 and a molecular weight of 644.02 g/mol. Its IUPAC name is (2S)-1-[tert-butyl(diphenyl)silyl]oxy-3-[4-[tert-butyl(diphenyl)silyl]oxyphenyl]propan-2-amine.
| Compound Name | (2S)-1-[tert-butyl(diphenyl)silyl]oxy-3-[4-[tert-butyl(diphenyl)silyl]oxyphenyl]propan-2-amine |
|---|---|
| PubChem CID | 11700207 |
| Molecular Formula | C41H49NO2Si2 |
| Molecular Weight | 644.02 g/mol |
| Exact Mass | 643.33 |
| IUPAC Name | (2S)-1-[tert-butyl(diphenyl)silyl]oxy-3-[4-[tert-butyl(diphenyl)silyl]oxyphenyl]propan-2-amine |
| SMILES | CC(C)(C)[Si](OC[C@@H](N)Cc1ccc(O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)cc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C41H49NO2Si2/c1-40(2,3)45(36-19-11-7-12-20-36,37-21-13-8-14-22-37)43-32-34(42)31-33-27-29-35(30-28-33)44-46(41(4,5)6,38-23-15-9-16-24-38)39-25-17-10-18-26-39/h7-30,34H,31-32,42H2,1-6H3/t34-/m0/s1 |
| InChIKey | BIXDNZRQLBTXSG-UMSFTDKQSA-N |
| XLogP | 7.07 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.02 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|