C31H44O2Si2 — CID 102246866
tert-butyl-[3-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]propoxy]-diphenylsilane (PubChem CID 102246866) has the molecular formula C31H44O2Si2 and a molecular weight of 504.86 g/mol. Its IUPAC name is tert-butyl-[3-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]propoxy]-diphenylsilane.
| Compound Name | tert-butyl-[3-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]propoxy]-diphenylsilane |
|---|---|
| PubChem CID | 102246866 |
| Molecular Formula | C31H44O2Si2 |
| Molecular Weight | 504.86 g/mol |
| Exact Mass | 504.29 |
| IUPAC Name | tert-butyl-[3-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]propoxy]-diphenylsilane |
| SMILES | CC(C)(C)[Si](C)(C)Oc1ccc(CCCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)cc1 |
| InChI | InChI=1S/C31H44O2Si2/c1-30(2,3)34(7,8)33-27-23-21-26(22-24-27)16-15-25-32-35(31(4,5)6,28-17-11-9-12-18-28)29-19-13-10-14-20-29/h9-14,17-24H,15-16,25H2,1-8H3 |
| InChIKey | NFANRYSGJGXTLI-UHFFFAOYSA-N |
| XLogP | 7.58 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.86 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|