C25H32O2Si — CID 11153578
tert-butyl-[5-(furan-3-yl)pentoxy]-diphenylsilane (PubChem CID 11153578) has the molecular formula C25H32O2Si and a molecular weight of 392.62 g/mol. Its IUPAC name is tert-butyl-[5-(furan-3-yl)pentoxy]-diphenylsilane.
| Compound Name | tert-butyl-[5-(furan-3-yl)pentoxy]-diphenylsilane |
|---|---|
| PubChem CID | 11153578 |
| Molecular Formula | C25H32O2Si |
| Molecular Weight | 392.62 g/mol |
| Exact Mass | 392.22 |
| IUPAC Name | tert-butyl-[5-(furan-3-yl)pentoxy]-diphenylsilane |
| SMILES | CC(C)(C)[Si](OCCCCCc1ccoc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H32O2Si/c1-25(2,3)28(23-14-8-4-9-15-23,24-16-10-5-11-17-24)27-19-12-6-7-13-22-18-20-26-21-22/h4-5,8-11,14-18,20-21H,6-7,12-13,19H2,1-3H3 |
| InChIKey | XYCXNTUUCCQRPC-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 22.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.62 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|