C30H42O2Si — CID 140893830
tert-butyl-[3-(5-heptylfuran-2-yl)propoxy]-diphenylsilane (PubChem CID 140893830) has the molecular formula C30H42O2Si and a molecular weight of 462.75 g/mol. Its IUPAC name is tert-butyl-[3-(5-heptylfuran-2-yl)propoxy]-diphenylsilane.
| Compound Name | tert-butyl-[3-(5-heptylfuran-2-yl)propoxy]-diphenylsilane |
|---|---|
| PubChem CID | 140893830 |
| Molecular Formula | C30H42O2Si |
| Molecular Weight | 462.75 g/mol |
| Exact Mass | 462.30 |
| IUPAC Name | tert-butyl-[3-(5-heptylfuran-2-yl)propoxy]-diphenylsilane |
| SMILES | CCCCCCCc1ccc(CCCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)o1 |
| InChI | InChI=1S/C30H42O2Si/c1-5-6-7-8-11-17-26-23-24-27(32-26)18-16-25-31-33(30(2,3)4,28-19-12-9-13-20-28)29-21-14-10-15-22-29/h9-10,12-15,19-24H,5-8,11,16-18,25H2,1-4H3 |
| InChIKey | DMAUGHHWEOUWAO-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 22.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.75 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|