C28H36O3Si — CID 102383328
2-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-6-ethyl-3,5-dimethylpyran-4-one (PubChem CID 102383328) has the molecular formula C28H36O3Si and a molecular weight of 448.68 g/mol. Its IUPAC name is 2-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-6-ethyl-3,5-dimethylpyran-4-one.
| Compound Name | 2-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-6-ethyl-3,5-dimethylpyran-4-one |
|---|---|
| PubChem CID | 102383328 |
| Molecular Formula | C28H36O3Si |
| Molecular Weight | 448.68 g/mol |
| Exact Mass | 448.24 |
| IUPAC Name | 2-[3-[tert-butyl(diphenyl)silyl]oxypropyl]-6-ethyl-3,5-dimethylpyran-4-one |
| SMILES | CCc1oc(CCCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)c(C)c(=O)c1C |
| InChI | InChI=1S/C28H36O3Si/c1-7-25-21(2)27(29)22(3)26(31-25)19-14-20-30-32(28(4,5)6,23-15-10-8-11-16-23)24-17-12-9-13-18-24/h8-13,15-18H,7,14,19-20H2,1-6H3 |
| InChIKey | MHEMXUZJZQZHHU-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.68 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|