C30H44OSi — CID 90132306
tert-butyl-diphenyl-tetradec-8-ynoxysilane (PubChem CID 90132306) has the molecular formula C30H44OSi and a molecular weight of 448.77 g/mol. Its IUPAC name is tert-butyl-diphenyl-tetradec-8-ynoxysilane.
| Compound Name | tert-butyl-diphenyl-tetradec-8-ynoxysilane |
|---|---|
| PubChem CID | 90132306 |
| Molecular Formula | C30H44OSi |
| Molecular Weight | 448.77 g/mol |
| Exact Mass | 448.32 |
| IUPAC Name | tert-butyl-diphenyl-tetradec-8-ynoxysilane |
| SMILES | CCCCCC#CCCCCCCCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C30H44OSi/c1-5-6-7-8-9-10-11-12-13-14-15-22-27-31-32(30(2,3)4,28-23-18-16-19-24-28)29-25-20-17-21-26-29/h16-21,23-26H,5-8,11-15,22,27H2,1-4H3 |
| InChIKey | YABGJOLDEMDEBY-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.77 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|