C26H32O2Si — CID 102173956
4-[4-[tert-butyl(diphenyl)silyl]oxybutyl]phenol (PubChem CID 102173956) has the molecular formula C26H32O2Si and a molecular weight of 404.63 g/mol. Its IUPAC name is 4-[4-[tert-butyl(diphenyl)silyl]oxybutyl]phenol.
| Compound Name | 4-[4-[tert-butyl(diphenyl)silyl]oxybutyl]phenol |
|---|---|
| PubChem CID | 102173956 |
| Molecular Formula | C26H32O2Si |
| Molecular Weight | 404.63 g/mol |
| Exact Mass | 404.22 |
| IUPAC Name | 4-[4-[tert-butyl(diphenyl)silyl]oxybutyl]phenol |
| SMILES | CC(C)(C)[Si](OCCCCc1ccc(O)cc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H32O2Si/c1-26(2,3)29(24-13-6-4-7-14-24,25-15-8-5-9-16-25)28-21-11-10-12-22-17-19-23(27)20-18-22/h4-9,13-20,27H,10-12,21H2,1-3H3 |
| InChIKey | GEMWDZDUAMALCT-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.63 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|