C29H36O3Si — CID 22345545
2-[4-[3-[tert-butyl(diphenyl)silyl]oxypropyl]phenoxy]-2-methylpropanal (PubChem CID 22345545) has the molecular formula C29H36O3Si and a molecular weight of 460.69 g/mol. Its IUPAC name is 2-[4-[3-[tert-butyl(diphenyl)silyl]oxypropyl]phenoxy]-2-methylpropanal.
| Compound Name | 2-[4-[3-[tert-butyl(diphenyl)silyl]oxypropyl]phenoxy]-2-methylpropanal |
|---|---|
| PubChem CID | 22345545 |
| Molecular Formula | C29H36O3Si |
| Molecular Weight | 460.69 g/mol |
| Exact Mass | 460.24 |
| IUPAC Name | 2-[4-[3-[tert-butyl(diphenyl)silyl]oxypropyl]phenoxy]-2-methylpropanal |
| SMILES | CC(C)(C=O)Oc1ccc(CCCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)cc1 |
| InChI | InChI=1S/C29H36O3Si/c1-28(2,3)33(26-14-8-6-9-15-26,27-16-10-7-11-17-27)31-22-12-13-24-18-20-25(21-19-24)32-29(4,5)23-30/h6-11,14-21,23H,12-13,22H2,1-5H3 |
| InChIKey | IEINAHUJVAMCOM-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.69 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|