C27H34O3Si — CID 88618126
tert-butyl-[2-[4-(2-hydroperoxypropan-2-yl)phenyl]ethoxy]-diphenylsilane (PubChem CID 88618126) has the molecular formula C27H34O3Si and a molecular weight of 434.65 g/mol. Its IUPAC name is tert-butyl-[2-[4-(2-hydroperoxypropan-2-yl)phenyl]ethoxy]-diphenylsilane.
| Compound Name | tert-butyl-[2-[4-(2-hydroperoxypropan-2-yl)phenyl]ethoxy]-diphenylsilane |
|---|---|
| PubChem CID | 88618126 |
| Molecular Formula | C27H34O3Si |
| Molecular Weight | 434.65 g/mol |
| Exact Mass | 434.23 |
| IUPAC Name | tert-butyl-[2-[4-(2-hydroperoxypropan-2-yl)phenyl]ethoxy]-diphenylsilane |
| SMILES | CC(C)(OO)c1ccc(CCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)cc1 |
| InChI | InChI=1S/C27H34O3Si/c1-26(2,3)31(24-12-8-6-9-13-24,25-14-10-7-11-15-25)29-21-20-22-16-18-23(19-17-22)27(4,5)30-28/h6-19,28H,20-21H2,1-5H3 |
| InChIKey | ZLLZZPRWCGXVDW-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.65 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|