C33H58O5Si — CID 71697287
(5S,6R,7R,8R)-7-[tert-butyl(dimethyl)silyl]oxy-6-methyl-8-[(4R,5R,6S)-2,2,5-trimethyl-6-[(2S)-1-phenylmethoxypropan-2-yl]-1,3-dioxan-4-yl]non-1-en-5-ol (PubChem CID 71697287) has the molecular formula C33H58O5Si and a molecular weight of 562.91 g/mol. Its IUPAC name is (5S,6R,7R,8R)-7-[tert-butyl(dimethyl)silyl]oxy-6-methyl-8-[(4R,5R,6S)-2,2,5-trimethyl-6-[(2S)-1-phenylmethoxypropan-2-yl]-1,3-dioxan-4-yl]non-1-en-5-ol.
| Compound Name | (5S,6R,7R,8R)-7-[tert-butyl(dimethyl)silyl]oxy-6-methyl-8-[(4R,5R,6S)-2,2,5-trimethyl-6-[(2S)-1-phenylmethoxypropan-2-yl]-1,3-dioxan-4-yl]non-1-en-5-ol |
|---|---|
| PubChem CID | 71697287 |
| Molecular Formula | C33H58O5Si |
| Molecular Weight | 562.91 g/mol |
| Exact Mass | 562.41 |
| IUPAC Name | (5S,6R,7R,8R)-7-[tert-butyl(dimethyl)silyl]oxy-6-methyl-8-[(4R,5R,6S)-2,2,5-trimethyl-6-[(2S)-1-phenylmethoxypropan-2-yl]-1,3-dioxan-4-yl]non-1-en-5-ol |
| SMILES | C=CCC[C@H](O)[C@@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](C)[C@@H]1OC(C)(C)O[C@@H]([C@@H](C)COCc2ccccc2)[C@H]1C |
| InChI | InChI=1S/C33H58O5Si/c1-13-14-20-28(34)24(3)31(38-39(11,12)32(6,7)8)26(5)30-25(4)29(36-33(9,10)37-30)23(2)21-35-22-27-18-16-15-17-19-27/h13,15-19,23-26,28-31,34H,1,14,20-22H2,2-12H3/t23-,24+,25+,26+,28-,29-,30+,31+/m0/s1 |
| InChIKey | PAWHZNGYDCZODP-JDBFOXTKSA-N |
| XLogP | 7.99 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.91 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|