C34H64O5Si2 — CID 11763383
(3R,5R,7S,10R,11S,12R)-3,11-bis[[tert-butyl(dimethyl)silyl]oxy]-10,12-dimethyl-13-phenylmethoxytridec-1-ene-5,7-diol (PubChem CID 11763383) has the molecular formula C34H64O5Si2 and a molecular weight of 609.05 g/mol. Its IUPAC name is (3R,5R,7S,10R,11S,12R)-3,11-bis[[tert-butyl(dimethyl)silyl]oxy]-10,12-dimethyl-13-phenylmethoxytridec-1-ene-5,7-diol.
| Compound Name | (3R,5R,7S,10R,11S,12R)-3,11-bis[[tert-butyl(dimethyl)silyl]oxy]-10,12-dimethyl-13-phenylmethoxytridec-1-ene-5,7-diol |
|---|---|
| PubChem CID | 11763383 |
| Molecular Formula | C34H64O5Si2 |
| Molecular Weight | 609.05 g/mol |
| Exact Mass | 608.43 |
| IUPAC Name | (3R,5R,7S,10R,11S,12R)-3,11-bis[[tert-butyl(dimethyl)silyl]oxy]-10,12-dimethyl-13-phenylmethoxytridec-1-ene-5,7-diol |
| SMILES | C=C[C@@H](C[C@H](O)C[C@@H](O)CC[C@@H](C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](C)COCc1ccccc1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C34H64O5Si2/c1-14-31(38-40(10,11)33(4,5)6)23-30(36)22-29(35)21-20-26(2)32(39-41(12,13)34(7,8)9)27(3)24-37-25-28-18-16-15-17-19-28/h14-19,26-27,29-32,35-36H,1,20-25H2,2-13H3/t26-,27-,29+,30-,31+,32+/m1/s1 |
| InChIKey | MXWAAUITEUDHTH-KKWMROGQSA-N |
| XLogP | 8.72 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.05 |
| LogP ≤ 5 | 8.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|