C30H54O4Si — CID 102465386
(E,4S,5R,6R,9R,10S,11R)-4-[tert-butyl(dimethyl)silyl]oxy-10-methoxy-5,7,9,11-tetramethyl-12-phenylmethoxydodec-7-en-6-ol (PubChem CID 102465386) has the molecular formula C30H54O4Si and a molecular weight of 506.84 g/mol. Its IUPAC name is (E,4S,5R,6R,9R,10S,11R)-4-[tert-butyl(dimethyl)silyl]oxy-10-methoxy-5,7,9,11-tetramethyl-12-phenylmethoxydodec-7-en-6-ol.
| Compound Name | (E,4S,5R,6R,9R,10S,11R)-4-[tert-butyl(dimethyl)silyl]oxy-10-methoxy-5,7,9,11-tetramethyl-12-phenylmethoxydodec-7-en-6-ol |
|---|---|
| PubChem CID | 102465386 |
| Molecular Formula | C30H54O4Si |
| Molecular Weight | 506.84 g/mol |
| Exact Mass | 506.38 |
| IUPAC Name | (E,4S,5R,6R,9R,10S,11R)-4-[tert-butyl(dimethyl)silyl]oxy-10-methoxy-5,7,9,11-tetramethyl-12-phenylmethoxydodec-7-en-6-ol |
| SMILES | CCC[C@H](O[Si](C)(C)C(C)(C)C)[C@H](C)[C@@H](O)/C(C)=C/[C@@H](C)[C@H](OC)[C@H](C)COCc1ccccc1 |
| InChI | InChI=1S/C30H54O4Si/c1-12-16-27(34-35(10,11)30(6,7)8)25(5)28(31)22(2)19-23(3)29(32-9)24(4)20-33-21-26-17-14-13-15-18-26/h13-15,17-19,23-25,27-29,31H,12,16,20-21H2,1-11H3/b22-19+/t23-,24-,25+,27+,28+,29+/m1/s1 |
| InChIKey | QDJKSQSZVWKVND-ZFYQGXCNSA-N |
| XLogP | 7.62 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.84 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|