C37H72O4Si3 — CID 11763772
[(E,4R,5R,6S,7R)-5,7-bis[[tert-butyl(dimethyl)silyl]oxy]-2,4,6-trimethyl-9-phenylmethoxynon-2-enoxy]-tert-butyl-dimethylsilane (PubChem CID 11763772) has the molecular formula C37H72O4Si3 and a molecular weight of 665.24 g/mol. Its IUPAC name is [(E,4R,5R,6S,7R)-5,7-bis[[tert-butyl(dimethyl)silyl]oxy]-2,4,6-trimethyl-9-phenylmethoxynon-2-enoxy]-tert-butyl-dimethylsilane.
| Compound Name | [(E,4R,5R,6S,7R)-5,7-bis[[tert-butyl(dimethyl)silyl]oxy]-2,4,6-trimethyl-9-phenylmethoxynon-2-enoxy]-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 11763772 |
| Molecular Formula | C37H72O4Si3 |
| Molecular Weight | 665.24 g/mol |
| Exact Mass | 664.47 |
| IUPAC Name | [(E,4R,5R,6S,7R)-5,7-bis[[tert-butyl(dimethyl)silyl]oxy]-2,4,6-trimethyl-9-phenylmethoxynon-2-enoxy]-tert-butyl-dimethylsilane |
| SMILES | C/C(=C\[C@@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)[C@@H](CCOCc1ccccc1)O[Si](C)(C)C(C)(C)C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C37H72O4Si3/c1-29(27-39-42(13,14)35(4,5)6)26-30(2)34(41-44(17,18)37(10,11)12)31(3)33(40-43(15,16)36(7,8)9)24-25-38-28-32-22-20-19-21-23-32/h19-23,26,30-31,33-34H,24-25,27-28H2,1-18H3/b29-26+/t30-,31+,33-,34-/m1/s1 |
| InChIKey | MDWXBUNGCOYAHK-ZUVVLFOUSA-N |
| XLogP | 11.61 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.24 |
| LogP ≤ 5 | 11.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|