C38H82O5Si4 — CID 11354610
(E,5R,6S,7R,8R)-3,5,7,11-tetrakis[[tert-butyl(dimethyl)silyl]oxy]-6,8,10-trimethylundec-9-en-2-one (PubChem CID 11354610) has the molecular formula C38H82O5Si4 and a molecular weight of 731.41 g/mol. Its IUPAC name is (E,5R,6S,7R,8R)-3,5,7,11-tetrakis[[tert-butyl(dimethyl)silyl]oxy]-6,8,10-trimethylundec-9-en-2-one.
| Compound Name | (E,5R,6S,7R,8R)-3,5,7,11-tetrakis[[tert-butyl(dimethyl)silyl]oxy]-6,8,10-trimethylundec-9-en-2-one |
|---|---|
| PubChem CID | 11354610 |
| Molecular Formula | C38H82O5Si4 |
| Molecular Weight | 731.41 g/mol |
| Exact Mass | 730.52 |
| IUPAC Name | (E,5R,6S,7R,8R)-3,5,7,11-tetrakis[[tert-butyl(dimethyl)silyl]oxy]-6,8,10-trimethylundec-9-en-2-one |
| SMILES | CC(=O)C(C[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](C)/C=C(\C)CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C38H82O5Si4/c1-28(27-40-44(17,18)35(5,6)7)25-29(2)34(43-47(23,24)38(14,15)16)30(3)32(41-45(19,20)36(8,9)10)26-33(31(4)39)42-46(21,22)37(11,12)13/h25,29-30,32-34H,26-27H2,1-24H3/b28-25+/t29-,30+,32-,33?,34-/m1/s1 |
| InChIKey | YORXFNLFBBTUDH-UCKDQRHDSA-N |
| XLogP | 12.38 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 731.41 |
| LogP ≤ 5 | 12.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|