C20H36O4Si — CID 88524635
2-acetyl-10-[tert-butyl(dimethyl)silyl]oxy-5,9-dimethyldeca-4,8-dienoic acid (PubChem CID 88524635) has the molecular formula C20H36O4Si and a molecular weight of 368.59 g/mol. Its IUPAC name is 2-acetyl-10-[tert-butyl(dimethyl)silyl]oxy-5,9-dimethyldeca-4,8-dienoic acid.
| Compound Name | 2-acetyl-10-[tert-butyl(dimethyl)silyl]oxy-5,9-dimethyldeca-4,8-dienoic acid |
|---|---|
| PubChem CID | 88524635 |
| Molecular Formula | C20H36O4Si |
| Molecular Weight | 368.59 g/mol |
| Exact Mass | 368.24 |
| IUPAC Name | 2-acetyl-10-[tert-butyl(dimethyl)silyl]oxy-5,9-dimethyldeca-4,8-dienoic acid |
| SMILES | CC(=O)C(CC=C(C)CCC=C(C)CO[Si](C)(C)C(C)(C)C)C(=O)O |
| InChI | InChI=1S/C20H36O4Si/c1-15(12-13-18(17(3)21)19(22)23)10-9-11-16(2)14-24-25(7,8)20(4,5)6/h11-12,18H,9-10,13-14H2,1-8H3,(H,22,23) |
| InChIKey | ICEPRWCHXXRMKB-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.59 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|