C38H66O3Si — CID 15895664
ethyl (2E,6Z,10E,14E,18E)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,10,15,19,23-pentamethyltetracosa-2,6,10,14,18,22-hexaenoate (PubChem CID 15895664) has the molecular formula C38H66O3Si and a molecular weight of 599.03 g/mol. Its IUPAC name is ethyl (2E,6Z,10E,14E,18E)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,10,15,19,23-pentamethyltetracosa-2,6,10,14,18,22-hexaenoate.
| Compound Name | ethyl (2E,6Z,10E,14E,18E)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,10,15,19,23-pentamethyltetracosa-2,6,10,14,18,22-hexaenoate |
|---|---|
| PubChem CID | 15895664 |
| Molecular Formula | C38H66O3Si |
| Molecular Weight | 599.03 g/mol |
| Exact Mass | 598.48 |
| IUPAC Name | ethyl (2E,6Z,10E,14E,18E)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,10,15,19,23-pentamethyltetracosa-2,6,10,14,18,22-hexaenoate |
| SMILES | CCOC(=O)/C(C)=C/CC/C(=C/CC/C(C)=C/CC/C=C(\C)CC/C=C(\C)CCC=C(C)C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C38H66O3Si/c1-13-40-37(39)35(7)27-19-29-36(30-41-42(11,12)38(8,9)10)28-18-26-33(5)22-15-14-21-32(4)24-17-25-34(6)23-16-20-31(2)3/h20-22,25,27-28H,13-19,23-24,26,29-30H2,1-12H3/b32-21+,33-22+,34-25+,35-27+,36-28- |
| InChIKey | OHYCGDSQJAFCGT-IOPLIICCSA-N |
| XLogP | 12.15 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.03 |
| LogP ≤ 5 | 12.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|