C15H24O2 — CID 134858518
ethyl (4Z)-4-ethylidene-8-methyl-2-methylidenenon-7-enoate (PubChem CID 134858518) has the molecular formula C15H24O2 and a molecular weight of 236.35 g/mol. Its IUPAC name is ethyl (4Z)-4-ethylidene-8-methyl-2-methylidenenon-7-enoate.
| Compound Name | ethyl (4Z)-4-ethylidene-8-methyl-2-methylidenenon-7-enoate |
|---|---|
| PubChem CID | 134858518 |
| Molecular Formula | C15H24O2 |
| Molecular Weight | 236.35 g/mol |
| Exact Mass | 236.18 |
| IUPAC Name | ethyl (4Z)-4-ethylidene-8-methyl-2-methylidenenon-7-enoate |
| SMILES | C=C(C/C(=C\C)CCC=C(C)C)C(=O)OCC |
| InChI | InChI=1S/C15H24O2/c1-6-14(10-8-9-12(3)4)11-13(5)15(16)17-7-2/h6,9H,5,7-8,10-11H2,1-4H3/b14-6- |
| InChIKey | CSXLBQORQOSILX-NSIKDUERSA-N |
| XLogP | 4.19 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.35 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|