C20H32O4 — CID 102307776
diethyl 2-[(2E,5Z)-5-ethylidene-9-methyldeca-2,8-dienyl]propanedioate (PubChem CID 102307776) has the molecular formula C20H32O4 and a molecular weight of 336.47 g/mol. Its IUPAC name is diethyl 2-[(2E,5Z)-5-ethylidene-9-methyldeca-2,8-dienyl]propanedioate.
| Compound Name | diethyl 2-[(2E,5Z)-5-ethylidene-9-methyldeca-2,8-dienyl]propanedioate |
|---|---|
| PubChem CID | 102307776 |
| Molecular Formula | C20H32O4 |
| Molecular Weight | 336.47 g/mol |
| Exact Mass | 336.23 |
| IUPAC Name | diethyl 2-[(2E,5Z)-5-ethylidene-9-methyldeca-2,8-dienyl]propanedioate |
| SMILES | C/C=C(\C/C=C/CC(C(=O)OCC)C(=O)OCC)CCC=C(C)C |
| InChI | InChI=1S/C20H32O4/c1-6-17(14-11-12-16(4)5)13-9-10-15-18(19(21)23-7-2)20(22)24-8-3/h6,9-10,12,18H,7-8,11,13-15H2,1-5H3/b10-9+,17-6+ |
| InChIKey | UTRXDXRPPBXWKY-MDIFYWTPSA-N |
| XLogP | 4.76 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.47 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|