C23H38OSi — CID 59479992
tert-butyl-[(2E)-2,6-dimethyl-9-phenylnona-2,6-dienoxy]-dimethylsilane (PubChem CID 59479992) has the molecular formula C23H38OSi and a molecular weight of 358.64 g/mol. Its IUPAC name is tert-butyl-[(2E)-2,6-dimethyl-9-phenylnona-2,6-dienoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(2E)-2,6-dimethyl-9-phenylnona-2,6-dienoxy]-dimethylsilane |
|---|---|
| PubChem CID | 59479992 |
| Molecular Formula | C23H38OSi |
| Molecular Weight | 358.64 g/mol |
| Exact Mass | 358.27 |
| IUPAC Name | tert-butyl-[(2E)-2,6-dimethyl-9-phenylnona-2,6-dienoxy]-dimethylsilane |
| SMILES | CC(=CCCc1ccccc1)CC/C=C(\C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H38OSi/c1-20(14-12-18-22-16-9-8-10-17-22)13-11-15-21(2)19-24-25(6,7)23(3,4)5/h8-10,14-17H,11-13,18-19H2,1-7H3/b20-14?,21-15+ |
| InChIKey | CFARRJSJLCJZQJ-FOUGXWNNSA-N |
| XLogP | 7.31 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.64 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|